Searched 4,843 files and found 819 matches in 2.61s.
| title | example | |
|---|---|---|
| Morse code | −− −−− ·−· ··· · −·−· −−− −·· · | |
| Vyxal | ₁ƛ₍₃₅kF½*∑∴, | |
| Sheep | — Tree of Pythagoras | |
| De Bruijn index | λ λ λ 3 1 (2 1) | |
| Glicol | ~gate: speed 2.0 | |
| Z-flat | ~/ factorial /~ | |
| RTF | {\rtf1\ansi{\fonttbl\f0\fswiss Helvetica;}\f0\pard | |
| Indental | {NAME:{KEY:VALUE,LIST:[ITEM1,ITEM2])} | |
| swizzle | {M | |
| Project Mentat | {:db/id :person/email | |
| EDN | {:a 1, "foo" :bar, [1 2 3] four} | |
| fay | {-# LANGUAGE EmptyDataDecls #-} | |
| klong | {&/x!:\2+!_x^1%2} | |
| Twig | {% extends "base.html" %} | |
| avro | {"namespace": "example.avro", | |
| False | { writes all prime numbers between 0 and 100 } | |
| mpl | { Planning.mpl } | |
| jplace | { | |
| Observable | { | |
| Nix | { | |
| Hjson | { | |
| JSON-stat | { | |
| ddfql | { | |
| JSON5 | { | |
| Open Data Protcol | { | |
| CSVw | { | |
| JSON Schema | { | |
| Livr | { | |
| Joyfully Universal Language for (Inline) Assembly | { | |
| rason | { | |
| ArkScript | { | |
| JSON Graph Spec | { | |
| Metaweb Query Language | { | |
| json-graph-format | { | |
| ScriptEase | while( ThereAreUncalledNamesOnTheList() == true){ | |
| TQL | where appeared > 2009 | |
| AmbientTalk | when: ChatService discovered: { |chatService| when: chatService<-login(roomID, username) becomes: { |chatRoom| chatRoom<-chat("hello world"); // async message send whenever: chatRoom disconnected: { system.println("you're offline"); }; whenever: chatRoom reconnected: { system.println("you're online again"); }; }; }; | |
| Procfile | web: bundle exec rails server -p $PORT | |
| Ohayo | web.get ohayo/packages/samples/welcome.md | |
| Vely | void list_employees() { | |
| qed-lang | void Button(string text) { | |
| FaCT | void | |
| HCL | variable "ami" { | |
| zenscript | var x = 5; | |
| epsilon | var m : new Model; | |
| Hyperscript | var h = require('hyperscript') | |
| Uniform eXchange Format | uxf 1 | |
| zz | using |
|
| Jule | use std::math::{PI} | |
| Hare | use fmt; | |
| albatross | use alba.base.boolean | |
| Invisible XML | url: scheme, ":", authority, path. | |
| goose | uint(32) lomarf( uint(32) a, uint(32) b ) | |
| EverParse3D | typedef struct _OrderedPair { | |
| Ion Schema Language | type::{ | |
| Reason | type schoolPerson = Teacher | Director | Student(string); | |
| Markus | type User: user { | |
| BARE | type PublicKey data[128] | |
| luau | type Point = { x: number, y: number } | |
| Fable | type Face = | |
| Candy | type = use "..Type" | |
| Browser Extensible Data Format | track name=pairedReads description="Clone Paired Reads" useScore=1 | |
| PromQL | topk(3, sum by (app, proc) (rate(instance_cpu_time_ns[5m]))) | |
| KAML | title="KAML Example" # A simple string | |
| Markwhen | title: Welcome to Markwhen 👋 | |
| Tree Notation | title Tree Notation | |
| Scroll | title This is Scroll. The keyword for title is title. | |
| world | timeval: struct [ | |
| Kal | task getUserFriends (userName) | |
| Imba | tag app-canvas | |
| Lucid | table_ [rows_ "2"] | |
| AsciiMath | sum_(i=1)^n i^3=((n(n+1))/2)^2 | |
| eqn | sum from { k = 1 } to N { k sup 2 } | |
| ink-lang | std := load('std') | |
| X PixMap | static char* |
|
| PEG.js | start | |
| Public Key File | ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAAAgQCw3QQtYgRViVH8ZpkQ2A7BuCeyPYC4hB9kKNhxwUfJ2hFgW8soGMBhsLN+vOeAJ2IXDMsezJO2/qhoZFQMvHoWpWTRTLPeNtBsKD+nhOZX28A4D+QRzVZ6hdWoh9W+mIP69MIT3aX35oLb86IycbNdRJlEK4FAUt7tjezNkU7boQ== root@use1-2.nitrousbox.com | |
| Devicetree | soc { | |
| Space | settings | |
| Note | settings | |
| Cirru | set a | |
| AMPL | set PROD; # products | |
| strat | service HelloWorld { | |
| bml | server | |
| Definite clause grammar | sentence --> noun_phrase, verb_phrase. | |
| Explorer | selection Canada~India | |
| XQL | select result:<$book.title, $book.author> | |
| OQL | select c.address | |
| Lorel | select Guide.restaurant.name, | |
| webql | select | |
| Lily | scoped enum Color { Black, Blue, Cyan, Green, Magenta, Red, White, Yellow } | |
| TextMate Language | scopeName = 'source.untitled'; | |
| Catala | scope QualifiedEmployeeDiscount : | |
| Link | save x, text 10 # create | |
| Citrine | salut := 'Bună țară!'. | |
| ACT-III | s1'dim'a'500'm'500'q'500'' | |
| KRL | ruleset sample { | |
| YARA | rule silent_banker : banker | |
| ATLAS Transformation Language | rule TreeNodeRoot2RootElement { | |
| rosie | rosie --rpl 'd = [:digit:]' -o json match d | |
| Forsyth-Edwards Notation | rnbqkbnr/pppppppp/8/8/8/8/PPPPPPPP/RNBQKBNR w KQkq - 0 1 | |
| BitBake | require qt5-git.inc | |
| Yacas | record["name"]:="Isaia"; | |
| Cell | reactive Thermostat { | |
| QUEL | range of E is EMPLOYEE | |
| Biological Expression Language | r(HGNC:CFTR, var("r.1653_1655delcuu")) | |
| abs | r = $(curl "http://data.nba.net/prod/v1/20170201/0021600732_boxscore.json" -H 'DNT: 1' -H 'Accept-Encoding: gzip, deflate, sdch' -H 'Accept-Language: en' -H 'User-Agent: Mozilla/5.0 (Macintosh; Intel Mac OS X 10_11_6) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/57.0.2987.133 Safari/537.36' -H 'Accept: */*' -H 'Referer: http://stats.nba.com/' -H 'Connection: keep-alive' --compressed); | |
| Dogescript | quiet | |
| UnQL | query Q1 := | |
| Ć | public class HelloCi | |
| hacspec | pub type Res = (usize, usize); | |
| Unicon | procedure main() | |
| High Level Assembly | procedure SetFormat; | |
| Vale | procedure ReadA(ghost a:seq(uint32),inline b:bool) | |
| ALGOL 60 | procedure Absmax(a) Size:(n, m) Result:(y) Subscripts:(i, k); | |
| Quake | proc simple(prefix, suffix) is | |
| llhd | proc %Accumulator.always_comb.227.0 (i1$ %0, i16$ %1, i16$ %2) -> (i16$ %3) { | |
| Blox | print(1+2*3/4) | |
| Nit | print "Hello, World!" | |
| gura | prime() = { | |
| Bossam Rule Language | prefix family = http://family.com/Family#; | |
| Kamby | planet = [ | |
| CBOR data definition language | pii = ( | |
| Datalog | parent(john, douglas). % store some data | |
| UCL | param = value; | |
| RoboMind | paintWhite | |
| FML | pad = x flip[stitch] 0, stitch 0, flip[cat] 0, cat 0 | |
| emfatic | package test; | |
| odin | package main | |
| Carbon | package Sorting api; | |
| Lil | on mode a do # line comment | |
| baysick | object SquareRoot extends Baysick { | |
| GLMS | number w = 640; | |
| funl | ns main | |
| Blacklight | newq newq ;; create send and receive queues | |
| Wavefront Material | newmtl flat_green | |
| Rholang | new helloworld, stdout(`rho:io:stdout`) in { | |
| net-format | net chr2L 23011544 | |
| z2 | namespace org.z2legacy.samples.ut; | |
| C3 | module stack |
|
| Alpaca | module simple_example | |
| Croc | module samples.interfaces | |
| MiniD | module matrix | |
| Astatine | module Main where | |
| hamler | module Main where | |
| Gren | module Main exposing (main) | |
| Rescript | module Button = { | |
| Aith | module :: | |
| Parlog | mode qsort(list?,sorted_list^). | |
| DM | mob | |
| Đ | method satExample() or ({generator _ () | |
| kaitai | meta: | |
| Protocol Buffers | message Person { | |
| iikuse | me i kusin - I saw it | |
| Bla | map(f,[]) = [] | |
| JSON lambda | map (\o -> { sha: o.sha, ps: map _.sha o.parents }) | filter (\o -> length o.ps > 1) | |
| Arden syntax | maintenance: | |
| Alma | macro swap(a, b) { | |
| Finite State Language | machine_name: "Traffic light"; | |
| cosh | lsr; [test m] grep; [f<; [data m] grep] map | |
| Omgrofl | lol iz 71 | |
| pasukon | lex | |
| bog | let {print} = import "std.io" | |
| Serious | let x = 3; | |
| hazel | let v = {} in | |
| expresso | let sqmag = {x, y} -> x*x + y*y | |
| Stutter | let ratio be a Number and set it to 0.37 | |
| Fibonacci | let john = role Person | |
| plot | let html = HTML( | |
| OK | let divide = fn(a, b) { | |
| UCG | let db_confs = import "db/mysql/hosts.ucg"; | |
| Austral | let db: Db := connect("localhost"); | |
| imp-lang | let colors = "apples" x "red" | "apples" x "green" | "oranges" x "orange" in | |
| Low* | let chacha20 | |
| PowerQuery M | let Orders = Table.FromRecords({ | |
| Grammar | latinNode | |
| MUMPS | label1 ; This is a label | |
| mckeeman-form | json | |
| ELFE | invoke "sensor.corp.net", | |
| OMG IDL | interface A { | |
| Aime | integer | |
| ROS Message | int32 x | |
| Vala | int main (string[] args) { | |
| praxis-lang | insert data.scene_data.linus_wakes_up | |
| Pig Latin | input_lines = LOAD '/tmp/word.txt' AS (line:chararray); | |
| Céu | input int KEY; | |
| spiral | inl x = 2 // Define a 64-bit integer in Spiral. | |
| Genie | init | |
| Cali-Lang | include console; | |
| XCompose | include "%L" | |
| MDX | import { Chart } from '../components/chart' | |
| Picat | import util. | |
| torchscript | import torch | |
| Worst | import syntax/attributes | |
| Spatial | import spatial.dsl._ | |
| Flow9 | import runtime; | |
| clay | import printer.(println); | |
| Cyber | import m 'math' | |
| V | import json | |
| janet | import joy) | |
| converge | import Sys | |
| tao3d | import SeasonsGreetingsTheme | |
| PureScript | import Prelude | |
| blz | import Lists | |
| mgmt | import "datetime" | |
| pointless | import "chart.ptls" as chart | |
| comby | if (:[_] && :[height] :[_]) | |
| Toy | if (1 < 2) { | |
| HScript | if ( $F == 1 ) then | |
| Elvish | if $true { echo good } else { echo bad } | |
| DOI | https://doi.org/10.1000/182 | |
| h | h | |
| Scrapscript | greet <| person:ron 3 | |
| Graph Modeling Language | graph | |
| Xtext | grammar org.eclipse.xtext.common.Terminals | |
| Raku | grammar Parser { | |
| mermaid | gitGraph: | |
| General-purpose macro processor | gema -match -p 'Title\:*\n=$0@end' foo | |
| xs | gcd:{([`x`y]):..;if y==0(x)(y gcd x mod y)}; | |
| NL | g3 0 1 0 # problem assign0 | |
| Gremlin | g.V().hasLabel('movie').values('year').min() | |
| Jakt | function main() { | |
| Adventure Game Studio Script | function hDoor_Look() | |
| GEL Genius | function f(x) = ( | |
| JLang | func test param { | |
| never | func main() -> float | |
| sora | func get(node: &mut Foo, k: usize) -> maybe &mut Foo { | |
| rise | fun(A : N.K.float => fun(B : K.M.float => | |
| mythryl | fun qsort [] => []; qsort (x!xs) => qsort (filter {. #a < x; } xs) @ [x] @ qsort (filter {. #a >= x; } xs); end; | |
| Koka | fun hello-ten() | |
| manticore | fun forever (init : ’a) (f: ’a -> ’a) : unit = | |
| lila-lang | fun fib(n:Int) (Int) { | |
| Linux Kernel Module | fs/mbcache.ko | |
| Seq | from sys import argv | |
| Numba | from numba import njit | |
| PRQL | from employees | |
| CodeQL | from DataFlow::PathNode source, DataFlow::PathNode sink, UnsafeDeserializationConfig conf | |
| dio | for v in [5, 8, 32, 9, 14] | |
| CGOL | for i in 1 to n do | |
| latte-js | for (x in y if (x.is('awesome'))) | |
| WCPS | for $c in ( M1, M2, M3 ), | |
| Alumina | fn main() { | |
| mun-lang | fn main() { | |
| neeilang | fn main() : Int { | |
| Tao | fn factorial = | |
| dslx | fn cast_to_array(x: u6) -> u2[3] { | |
| Maude | fmod FACTORIAL is | |
| Jevko | first name [John] | |
| AviSynth | filename="somefile.avi" | |
| TI-89 series | fib(n) | |
| strudel | feature Rice 1 LOC_Os05g01020 gene 1903 "TBC domain containing protein, expressed" | |
| kona | factorial:{*/1+!:x} | |
| Verse | f(p:int,q:int):int := | |
| orange | extern printf(char* s, ...) -> int32 | |
| Vale | exported func main() { | |
| walt | export function fibonacci(n: i32): i32 { | |
| Violent ES | enum Product { | |
| Thrift | enum PhoneType { | |
| GraphIt | element Vertex end | |
| ten | each( irange( 1, 101 ) | |
| Slim | doctype html | |
| MDBS-QRS | disp i dept location | |
| zolang | describe Person { | |
| p4p | defvar: m = 10 | |
| Bayer Expressions | define | edge? g e | |
| s-lang | define init_array (a) | |
| tremor-query | define grouper::bucket operator kfc; | |
| Sweet Expressions | define fibfast(n) ; Typical function notation | |
| I-expressions | define | |
| Mojo | def softmax(lst): | |
| hakaru | def pulls(strength real): | |
| Bython | def print_message(num_of_times) { | |
| Virgil | def main() { | |
| Crema | def int binarySearch(int values[], int searchTarget){ | |
| Luna | def greet(name:string) | |
| concurnas | def gcd(x int, y int){//greatest common divisor of two integers | |
| Mirah | def foo(a:String, b:int) | |
| Berry | def fib(x) | |
| Vigil | def fib(n): | |
| mochi | def factorial(n, m): | |
| Wart | def (foo (a | (b c))) # 'b' and 'c' name parts of list 'a' | |
| vdscript | declare foo; | |
| DDF | ddf--datapoints--population--by--geo--year.csv | |
| pyret | data BinTree: | |
| Goal | csvs:"\n"_` | |
| Earl Grey | count-words(text) = | |
| 2-pak | coroutine FRUIT_GEN() | |
| OCL | context Person inv: self.age >=0 | |
| Superjson | const object = { | |
| LISP 1.5 | cons (a (b c d)) | |
| specrtl | concrete *cmp_ccno_1.insn instantiates set_compare | |
| Conceptual | concept | |
| Praat Script | clearinfo | |
| Grace | class cat { | |
| Nuua | class Triangle { | |
| MoonScript | class Thing | |
| Tea | class Square Rectangle ( | |
| Scala.js | class Person(val firstName: String, val lastName: String) { | |
| MINI OBJECT-ORIENTED LANGUAGE | class File { | |
| JSX | class App extends React.Component { | |
| tablam | city ?where .population > 100_000 ?select .name, .country | |
| chain-format | chain 4900 chrY 58368225 + 25985403 25985638 chr5 151006098 - 43257292 43257528 1 | |
| Carpet | cadef | |
| Concise Encoding | c1 | |
| PLZ | bubble sort MODULE | |
| Wing | bring cloud; | |
| METAPOST | beginfig(2); | |
| SRL | begin with any of (digit, letter, one of "._%+-") once or more, | |
| reforth | begin | |
| beads-lang | beads level 1 program calculator | |
| shakti | b + 1 2 3 | |
| D2 | aws: { | |
| Typoscript | asdf { | |
| Dashrep | animal-type: | |
| G-Portugol | algoritmo OlaMundo; | |
| whalecalf | algorithm=trellis; | |
| xduce | addrbook[ | |
| Pony | actor Main | |
| Varnish Configuration Language | acl local { | |
| yeti | ack m n = | |
| JSL | a="Hello"; b=" "; c="World"; a||b||c; | |
| ssl-lang | a+b* | |
| taktentus | a := 15 | |
| ed script | a | |
| visdown | ```vis | |
| SQF | _num = 10; | |
| Djot | _italic_ | |
| Set-builder notation | \{l\ |\ l\in L\} | |
| Pickle | \x80\x03cpandas.core.frame\nDataFrame\nq\x00)\x81q\x01}q\x02(X\x05\x00\x00\x00_dataq\x03cpandas.core.internals\nBlockManager\nq\x04)\x81q\x05(]q\x06(cpandas.core.indexes.base\n_new_Index\nq\x07cpandas.core.indexes.base\nIndex\nq\x08}q\t(X\x04\x00\x00\x00dataq\ncnumpy.core.multiarray\n_reconstruct\nq\x0bcnumpy\nndarray\nq\x0cK\x00\x85q\rC\x01bq\x0e\x87q\x0fRq\x10(K\x01K\x02\x85q\x11cnumpy\ndtype\nq\x12X\x02\x00\x00\x00O8q\x13K\x00K\x01\x87q\x14Rq\x15(K\x03X\x01\x00\x00\x00|q\x16NNNJ\xff\xff\xff\xffJ\xff\xff\xff\xffK?tq\x17b\x89]q\x18(X\x03\x00\x00\x00Catq\x19X\x03\x00\x00\x00Dogq\x1aetq\x1bbX\x04\x00\x00\x00nameq\x1cNu\x86q\x1dRq\x1eh\x07cpandas.core.indexes.range\nRangeIndex\nq\x1f}q (h\x1cNX\x05\x00\x00\x00startq!K\x00X\x04\x00\x00\x00stopq"K\x02X\x04\x00\x00\x00stepq#K\x01u\x86q$Rq%e]q&h\x0bh\x0cK\x00\x85q\'h\x0e\x87q(Rq)(K\x01K\x02K\x02\x86q*h\x12X\x02\x00\x00\x00f8q+K\x00K\x01\x87q,Rq-(K\x03X\x01\x00\x00\x00 |
|
| Noweb | \section{Hello world} | |
| Literate Agda | \documentclass{article} | |
| XeTeX | \documentclass[11pt]{article} | |
| CWEB | \datethis | |
| LARP | \\ Simple pseudo code | |
| Xidoc | [section HTML; | |
| idyll | [meta | |
| topaz | [i: 0 while [i < 10] [i: i + 1]] | |
| tuplemarkup | [html | | |
| Calc4 | [fib2|x, a, b|x ? ((x-1) ? ((x-1) {fib2} (a+b) {fib2}a) ? a) ? b] 38{fib2}1{fib2}0 | |
| PML | [doc [title PML Demo] | |
| ArchieML | [days] | |
| Ren | [] ; empty list | |
| WebGPU Shading Language | [[location 0]] var |
|
| desktop | [Desktop Entry] | |
| Datomic | [:find ?e | |
| kerf | [100] + [0, 10, 20] | |
| Wikitax | [* | |
| beautiful-report-language | [(define myname "Bruce") | |
| SMILES arbitrary target specification | [$([NH2][CX4]),$([NH]([CX4])[CX4]),$([NX3]([CX4])([CX4])[CX4])] | |
| jcard | ["vcard", | |
| JSON Lines | ["Name", "Session", "Score", "Completed"] | |
| [x]it! | [ ] This is an open item | |
| GUIDO music notation | [ \clef<"treble"> \key<"D"> \meter<"4/4"> | |
| maraca-lang | [ | |
| Executable JSON | [ | |
| jeebox | You can %describe (anything, in: Jeebox) | |
| CSV | Year,Make,Model,Length | |
| XML Query Language | WHERE |
|
| Robots.txt | User-agent: googlebot # all Google services | |
| o42a | Use namespace 'Console' | |
| holyc | U0 Main() | |
| Jesth | This text actually belongs to an anonymous section, | |
| Em | This is an optional HTML title. | |
| Stencil | There are {{ articles.count }} articles. | |
| Plain English | The background is a picture. | |
| dbml | Table users { | |
| moinmoin | Table of contents: | |
| Push | TIMES2 | |
| flowlog | TABLE stolen(switchid ); | |
| Wren | System.print("Hello, world!") | |
| Acme | System simple_cs = { | |
| mathics | StringJoin[Riffle[Map[ToString, Table[Fibonacci[i], {i,16}]], ", "]] <> "..." | |
| Truth | String | |
| Spline Font Database | SplineFontDB: 3.0 | |
| Go! | Sex ::= male | female. | |
| GAMS | Sets | |
| CCS | Script-Filter: | |
| Wirth syntax notation | SYNTAX = { PRODUCTION } . | |
| AGC | SWCHSET STORE NOMTPI | |
| UnQL | SELECT {articleout:cool_nosql_collection.docNumber} FROM cool_nosql_collection | |
| edgeql | SELECT User FILTER User.name = 'John'; | |
| IBM Informix-4GL | SELECT UNIQUE city, state, zipcode, sname | |
| MultiDimensional eXpressions | SELECT | |
| EXPRESS | SCHEMA Family; | |
| snakemake | SAMPLES = "100 101 102 103".split() | |
| MathLingua | Result: | |
| Readable | Red [ | |
| Tefkat | RULE ClassToTable | |
| Post-X | REPLACE GRAM := "<"^BREAK">"^"> '' | |
| BrightScript | REM | |
| Avail | Public method "Play Wump the Wumpus with reader_with reporter_" is | |
| JCOF | Programmer;"age""first-name""full-time""occupation"; | |
| UNITY | Program bubblesort | |
| ISWIM | Print `Hello world' | |
| 05AB1E | PUSH 4 | |
| ShEx | PREFIX : |
|
| Planguage | PLAN [01-Sep 2012]: Full product release | |
| CMS Pipelines | PIPE (end ?) | |
| ppm-format | P3 | |
| Netpbm grayscale image format | P2 | |
| Portable Bit Map Format | P1 | |
| Pharo | Object subclass: #Counter | |
| Genero Business Development Language | OPTIONS SHORT CIRCUIT | |
| dedukti | Nat: Type. | |
| tablatal | NAME AGE COLOR | |
| Rockstar | Midnight takes your heart and your soul | |
| MIME | MIME-Version: 1.0 | |
| Limbo | Lock: module | |
| Lexon | LEX Escrow. | |
| SQRL | LET Username := input(); | |
| Wiswesser line notation | L66J BMR& DSWQ IN1&1 | |
| QML | Item { | |
| guru | Inductive trie : Fun(A:type).type := | |
| Visual Basic .NET | Imports System.Console | |
| tangledown | If you eat t[number](cookies ' cookies'), you consume t[](calories ' calories'). This constitutes t[](dailypercent percent) of a daily intake of t[number](100 | |
| tsquery | Identifier[name="Animal"] | |
| BALGOL | INTEGER I..., J..., K..., L..., M..., N...$ | |
| Tutorial D | INSERT myVariable RELATION { | |
| Relational Data File | IF (x AUTHORED PAPER y) | |
| mustache | Hello {{name}} | |
| chef | Hello World Souffle. | |
| LOLCODE | HAI 1.3 | |
| Ron | GameConfig( // optional struct name | |
| BCPL | GET "LIBHDR" | |
| Wonkey | Function Add( a:Int, b:Int ) | |
| Halide | Func blur_3x3(Func input) { | |
| operon | From json:true | |
| EML | From MAILER-DAEMON Fri Jul 8 12:08:34 2011 | |
| ASN.1 | FooProtocol DEFINITIONS ::= BEGIN | |
| Gherkin | Feature: Guess the word | |
| Margin | Favorite Movies | |
| xsharp | FUNCTION start AS VOID | |
| Zimbu | FUNC Main() int | |
| Formula language | FIELD NewDate:=@Today | |
| PEG | Expr ← Sum | |
| DAX | EVALUATE | |
| nlpl | Draw a red circle | |
| DokuWiki | DokuWiki supports **bold**, //italic//, __underlined__ and ''monospaced'' texts. | |
| Yedalog | Documents = Load{path: "document-parse-trees"}; | |
| rbscript | Dim years, days As Integer | |
| Breccia | Definition of terms for project Breccia | |
| Linked Markdown | Definition Name | |
| Perfectscript | Declare Test[10] | |
| rapidgen-rpl | Days_leave <- 22 | |
| c-talk | CtkObject myPrimitive(int nArgs, CtkObject* args) { | |
| Mathpix Markdown | Compute \(f(x) = x^2 + 2\) if \(x=2\). | |
| SYBYL line notation | C[1]H:CH:CH:CH:CH:CH:@1 | |
| CSP | COPY = *[c:character; west?c → east!c] | |
| SNQL: A Social Network Query and Transformation Language | CONSTRUCT CP1 | |
| QMake | CONFIG += qt debug | |
| Smiles | CC(=O)NCCC1=CNc2c1cc(OC)cc2 | |
| Structured Control Language | CASE TW OF | |
| Molfile | C8H10N4O2 | |
| plantuml | Bob->Alice : hello | |
| vCard | BEGIN:VCARD | |
| iCalendar | BEGIN:VCALENDAR | |
| Data Communications ALGOL | BEGIN | |
| Post production | Alphabet: {[, ]} | |
| System V ABI | Address Type Name | |
| Formatted Table | ACCEPTABLE LEFT PRIMERS | |
| SCROLL | A$/BCD$IEF$ | |
| prompter | A poor young straight Ancient Roman man. By reputation he is | |
| Liso | @varsrec | |
| MOO | @program toy:wind | |
| FOAF | @prefix rdf: |
|
| Turtle | @prefix rdf: |
|
| TriG syntax | @prefix rdf: |
|
| RDF Schema | @prefix rdf: |
|
| Notation3 | @prefix dc: |
|
| Bicep | @minLength(3) | |
| NilScript | @implementation TheClass { | |
| CSS Doodle | @grid: 14 / 80%; | |
| LES | @[#static] | |
| FASTQ | @SEQ_ID | |
| Scribe | @MakeSection(tag=beginning, title="The Beginning") | |
| ProbeVue | @@syscall:*:read:entry | |
| txr | @(bind special-words ("arch." "var." "ver." "anci." "fam.")) | |
| hilvl | @ var foo = 42 | |
| Pod6 | =begin pod | |
| Ragel | =begin | |
| Frost | ======================================================== | |
| dllup | === | |
| texti | = Markup language = | |
| MediaWiki | = Heading 1 = | |
| tilton | <~set~year~2000~> | |
| xt3d | ||
| XSD | ||
| ERB | ||
| RHTML | ||
| Template Attribute Language | ||
| Water | ||
| YESS | ||
| Svelte | ||
| htmx | ||
| Schematron | ||
| Security Assertion Markup Language | ||
| Namespace Routing Language | ||
| Namespace-based Validation Dispatching Language | ||
| Semantic Web Rule Language | ||
| relax | ||
| mavo | ||
| Flare | ||
| N-Triples | ||
| tornado | ||
| Velocity Template Language | ||
| Groovy Server Pages | ||
| exkited | ||
| opengraph | ||
| CLiX markup | ||
| Document Structure Description | ||
| RDFa | ||
| Microdata HTML | ||
| HCard | ||
| Handlebars | ||
| ColdFusion Components | ||
| BML | ||
| wizml | ||
| Visual Tool Markup Language | ||
| GOLD | ||
| Zork Implementation Language | ||
| xTAO Modeling Language | ||
| OEM | ||
| Content Assembly Mechanism | ||
| protium | <@ DEFAREFLE>pleac | |
| Speech Synthesis Markup Language | ||
| UML | ||
| DDML | ||
| xCard | ||
| MathML | ||
| Sitemap | ||
| RSS | ||
| Mako | <%inherit file="base.html"/> | |
| EEX | <%= if true do %> | |
| EJS | <% if (user) { %> | |
| Smarty | ||
| versioned-text-markup-language | ||
| Blade | ||
| Kit | ||
| chrysaLisp | ;imports | |
| ferret | ;;; lazy-sum.clj | |
| Guile | ;;; Hello world program | |
| lispyscript | ;; test with and without the "./" | |
| Topaz | ;; This is a comment | |
| wescheme | ;; The world is a number | |
| Fennel | ;; Sample: read the state of the keyboard and move the player accordingly | |
| carth | ;; Note that many of these functions are/will be in the standard | |
| Quaint | ;; Edit me! | |
| Plot | ;; A silly toy program | |
| NCAR Command Language | ;----------------------------------------------------------------- | |
| Ini | ; last modified 1 April 2001 by John Doe | |
| Slope | ; hello world | |
| neut | ; download the core library | |
| BeBasic | ; ____________________ | |
| SMT | ; Getting assertions | |
| Dak | ; Functions are varied and colorful. | |
| Bel | ; Bel in Bel. 9 October 2019, 9:14 GMT | |
| dex | :p x = 1. -- let binding | |
| toadskin | :V+++++; | |
| hoon | :: A message you ping another ship with | |
| ISBN | 978-3-16-148410-0 | |
| neralie-format | 6:00 250:000 12:00 500:000 | |
| I | 5 - *.o + 4 | |
| HiveQL | 4 CREATE TABLE word_counts AS | |
| Conway chained arrow notation | 3->3->2 = 7,625,597,484,987 | |
| CLPR | 3*X + 4*Y - 2*Z = 8, | |
| Soulver | 3 × 3 | |
| NumPad | 3 × 3 | |
| phylip | 3 30 | |
| Up-arrow notation | 2↑4 = 2 ^ 4 = 16 | |
| WebAssembly | 20 00 | |
| Gofer | 2 * (3+4) | |
| X Font Directory Index | 2 | |
| FRACTRAN | 17/65, 133/34, 17/19, 23/17, 2233/69, 23/29, 31/23, 74/341, 31/37, 41/31, 129/287, 41/43, 13/41, 1/13, 1/3 | |
| SubRip Text | 168 | |
| IRC chat logs | 12:06 Tantek: what does the datetime stamp represent? | |
| Common Log Format | 127.0.0.1 user-identifier frank [10/Oct/2000:13:55:36 -0700] "GET /apache_pb.gif HTTP/1.0" 200 2326 | |
| Semantic Versioning | 1.5.12 | |
| popr | 1 2 | 3 + | |
| libsvm-format | 1 10:3.4 123:0.5 34567:0.231 | |
| plink-ped-format | 1 1 0 0 1 0 G G 2 2 C C | |
| cat | 1 1 + | |
| Matrix Market Coordinate Format | 1 0 0 6 0 | |
| plink-bed-format | 0x6c 0x1b 0x01 0xdc 0x0f 0xe7 0x0f 0x6b 0x01 | |
| Combined Log Format | 0:0:0:0:0:0:0:1 - Administrator [17/Sep/2021:13:51:27 -0400] "GET /invoke/pub.flow/getTransportInfo" 200 2502 https://mycompany.com/test/webapp "Mozilla/5.0 (Windows NT 10.0; Win64; x64) AppleWebKit/537.36 (KHTML, like Gecko) Chrome/93.0.4577.63 Safari/537.36" | |
| arvelie-format | 02A01 2002-01-01 01D07 2001-02-18 | |
| XL | 0! is 1 | |
| axt-format | 0 chr19 3001012 3001075 chr11 70568380 70568443 - 3500 | |
| SimCode | //============================================================ | |
| XQL | //(editor contains "Leksh*") | |
| silk | // this is a comment | |
| Hocon | // one array | |
| xxl | // enclose (c)urly(b)races, (s)quare(b)brackets, (q)uotes: | |
| Mond | // documentation can be found here: https://github.com/Rohansi/Mond/wiki | |
| FLUX | // concrete node signatures | |
| Ark | // binding to printf | |
| Touch | // an inline comment // | |
| Language Server Index Format | // a vertex representing the document | |
| Slice | // YellowPages.ice | |
| ctalk-lang | // When working with the CTalk interpreter, | |
| Rust MIR | // WARNING: This output format is intended for human consumers only | |
| Boogie | // Variable a is a nested map that maps | |
| OpenVera | // This Examples shows how random | |
| PowerBuilder | // The MIT License (MIT) | |
| mlir | // Syntactically similar to LLVM: | |
| Ripple | // Stage | |
| Sublime Syntax Test Lang | // SYNTAX TEST "Packages/C/C.sublime-syntax" | |
| Solidity | // SPDX-License-Identifier: MIT | |
| SIL | // SIL is reliant on Swift's type system and declarations, so SIL syntax is an extension of Swift's. A .sil file is a Swift source file with added SIL definitions. The Swift source is parsed only for its declarations; Swift func bodies (except for nested declarations) and top-level code are ignored by the SIL parser. In a .sil file, there are no implicit imports; the swift and/or Builtin standard modules must be imported explicitly if used. | |
| CIR | // Read from local variable, address in %0. | |
| Eve | // People older than 30 | |
| Heron | // Named function with statement body | |
| Deno | // Imports `serve` from the remote Deno standard library, using URL. | |
| Fun | // Fun code | |
| Taichi | // For CPU | |
| tht | // Familiar variable and List syntax. | |
| dlvm | // Dimension-erased functions are flexible because input shapes are dynamic. | |
| Whiley | // Define the type of natural numbers | |
| fizz | // Code ---------------------------------------------------------------------------------------------------------------------------------- | |
| owen-lang | // An imperative, statically but weakly typed systems programming | |
| verifpal | // All lines that start with "//" are treated as comments and ignored by Verifpal | |
| mimium | // A minimal example below generates a sinewave of 440Hz: | |
| Jsonnet | // A function that returns an object. | |
| Alloy | // A file system object in the file system | |
| Flow | // @flow | |
| AsciiDots | /-& `` This is where the program ends! | |
| Lex | /*** Definition section ***/ | |
| ANTLR | /** Taken from "The Definitive ANTLR 4 Reference" by Terence Parr */ | |
| AssemblyScript | /** Calculates the n-th Fibonacci number. */ | |
| Closure Templates | /** | |
| Soy | /** | |
| Manchester syntax | /** | |
| Bison | /* Reverse Polish Notation calculator. */ | |
| Ion | /* Ion supports comments. */ | |
| bioscript | /* Initialization Omitted */ | |
| kai | /* // github.com/kai-language/issues/116 | |
| Linker Script | /* | |
| JSON with Comments | /* | |
| RenderScript | /* | |
| blockml | /* | |
| Adept | /* | |
| groff | .sp 1.5i | |
| Smali | .method public getTokens(I)I | |
| SCRIPT markup | .ez on | |
| CIL | .assembly Hello {} | |
| Incipit | .Enumeration incipit. | |
| gitignore | .DS_Store | |
| TI Program | .AlphaCS | |
| Information Presentation Facility | .* This is a comment line | |
| HXML | -cp src | |
| Objective-S | - |
|
| Unified Diff | --- /path/to/original timestamp | |
| Marp | --- | |
| manool | -- recursive version, MANOOLish "cascading" notation | |
| Hspec | -- file Spec.hs | |
| unison | -- comments start with `--` | |
| Terra | -- This top-level code is plain Lua code. | |
| Copilot | -- Raw temperature from sensor, range -50.0C to 100.0C. | |
| Egison | -- Extract all twin primes from the infinite list of prime numbers with pattern matching! | |
| zephyr-asdl | -- ASDL's 5 builtin types are: | |
| Dhall | -- ./company.dhall | |
| omega | -- | |
| ink | - I looked at Monsieur Fogg | |
| GAMS | *Basic example of transport model from GAMS model library | |
| Txt2tags | **bold text** | |
| Markdeep | **Example** | |
| Context Diff | *** /path/to/original timestamp | |
| flagship | ** File: hello1.prg // your first program | |
| Kami | * Main list element | |
| runic | * Header | |
| Creole | * Bullet list | |
| S-expressions | (x . y) | |
| Ciel | (set lambda fn) | |
| gnu-rtl | (set (reg:SI 140) | |
| datascript | (require '[datascript.core :as d]) | |
| Fuzuli | (require "/usr/lib/fuzuli/nfl/math.nfl") | |
| fleck | (println "Hello world!") | |
| FCL | (n) | |
| Common Lisp with Arc Macros and Procedures | (map [+ _ 1] '(1 2 3)) | |
| Pact | (map (+ 1) [1 2 3]) | |
| KiCad Legacy Layout | (kicad_pcb (version 3) | |
| Flatline | (if (missing? "00000") (random-value "000000") (f "000000")) | |
| Lush | (for (i 1 100) | |
| Allegro Common Lisp | (defun foo (x) | |
| ulisp | (defun b (x) (pinmode 13 t) (digitalwrite 13 x) (delay 500) (b (not x))) | |
| stella | (defun (lisp-null-array-symbol-string STRING) ((rank INTEGER)) | |
| Macchiato | (defn inc (x) (+ 1 x)) | |
| Atomese | (define find-animals | |
| g-expressions | (define build-exp | |
| taf | (define (make-person name email) | |
| KB | (defconcept circle () (center radius)) | |
| Loom | (defconcept air-base | |
| nydp | (def pre-compile (expr) | |
| OPS5 | (compute 2 + (3 * 4) + 5) | |
| wisp | (alert "Hello world!") | |
| lain | (add (sub 5 3) 2) ; Basic Math | |
| Reactive Plan Language | (DEF-INTERP-PROC LOOK-FOR (PL) | |
| Newick format | (A:0.1,B:0.2,(C:0.3,D:0.4):0.5); | |
| Todotxt | (A) Thank Mom for the meatballs @phone | |
| mimix-stream-language | (@lonely-planet Lonely Planet (@Hawaii) | |
| wah | (0 = 1) | |
| jasper | (+ 2 3) | |
| Hy | (+ "Hyllo " "World" "!") | |
| kilo-lisp | ((a . b) . c) | |
| The New Hampshire X Format | (((ADH2:0.1[&&NHX:S=human:E=1.1.1.1],ADH1:0.11[&&NHX:S=human:E=1.1.1.1]):0 | |
| Python Format Specification | '{0}, {1}, {2}'.format('a', 'b', 'c') | |
| alan | 'Reasons': collection { } | |
| Pomsky | 'Hello' ' '+ ('world' | 'pomsky') | |
| Caché Basic | ' RightTriangle compute area and hypotenuse of a right triangle | |
| HAML | %section.container | |
| Recfiles | %rec: Book | |
| Logos | %group iOS8 | |
| Sublime Syntax | %YAML 1.2 | |
| Refer | %A Brian W. Kernighan | |
| Sweave | %------------------------------------------- | |
| KaTeX | % \f is defined as #1f(#2) using the macro | |
| Turing | % Accepts a number and calculates its factorial | |
| Charity | % | |
| Multi-User Forth | $include $lib/strings | |
| Hodor | $HODOR: hhodor? Hodor!? Hodor!? oHooodorrhodor orHodor!? d = HoDoRHoDoR () { | |
| DIGITAL Command Language | $! Compiling with VAXC is said to work, but it requires the usual cruft | |
| Nginx | #user nobody; | |
| USD | #usda 1.0 | |
| srv | #request constants | |
| HyPhy | #profile START;s = 0;m = {5,1};for (k=0; k<250000; k=k+1){ s = s + k; t = Random (0,5); m [t] = m [t] + 1;}#profile PAUSE;s2 = 0;for (k=1; k<10000; k=k+1){ s2 = s2+1/k;}#profile _hyphy_profile_dump;stats = _hyphy_profile_dump["STATS"];_profile_summer = {1,Rows(stats)};_profile_summer = _profile_summer["1"] * stats;_instructions = _hyphy_profile_dump["INSTRUCTION"];_indices = _hyphy_profile_dump["INSTRUCTION INDEX"];fprintf (stdout, "\nTotal run time (seconds) : ", Format(_profile_summer[1]/1000000,15,6), "\nTotal number of steps : ", Format(_profile_summer[0],15,0), "\n\n"); for (k=0; k | |
| Filterscript | #pragma version(1) | |
| turnstile | #lang turnstile | |
| scribble | #lang scribble/doc | |
| rosette-lang | #lang rosette | |
| Patient-Oriented Prescription Programming Language | #lang pop-pl | |
| Hackett | #lang hackett | |
| Aardvark | #include os as os | |
| Nymph | #include |
|
| chaiscript | #include |
|
| ROOT | #include "Riostream.h" | |
| Felix | #import |
|
| JAI | #import "Basic"; | |
| X BitMap | #define test_width 16 | |
| order | #define ORDER_PP_DEF_8fib \ | |
| jiyu | #clang_import | |
| Rust HIR | #[prelude_import] | |
| Cue | #Spec: { | |
| Nexus file | #NEXUS | |
| lav-format | #:lav | |
| kivy-lang | #:kivy 1.0 | |
| Org | #+OPTIONS: H:3 num:nil toc:nil \n:nil @:t ::t |:t ^:t -:t f:t *:t TeX:t LaTeX:t skip:nil d:(HIDE) tags:not-in-toc | |
| LookML | ###################################### | |
| storyscript | ### | |
| World of Warcraft Addon Data | ## Interface: 70300 | |
| CFEngine | #!/var/cfengine/bin/cf-agent --no-lock | |
| gentee | #!/usr/local/bin/gentee | |
| P* | #!/usr/bin/wpl -f | |
| Parrot Assembly | #!/usr/bin/env parrot | |
| OpenRC runscript | #!/sbin/openrc-run | |
| winxed | #! winxed | |
| BQN | #! /usr/bin/env bqn | |
| Nadesiko | # 取り込みテスト | |
| Yet Another Scripting Language | # simple program that iteratively calculates factorials | |
| rbs | # sig/merchant.rbs | |
| Fardlang | # hehe fard dis is a fardy comment | |
| Embedded Crystal | # greeting.ecr | |
| CSpydr | # fibonacci.csp | |
| Mu | # dump stack from bottom to top | |
| Streem | # channel to broadcast to all clients | |
| DOML | # Version 0.3 | |
| Triton | # This is a GPU kernel in Triton. | |
| Please Build | # Taken from //src/core/BUILD in the Please repo | |
| DTrace | # Syscall count by syscall | |
| OpenType Feature File | # Script and language coverage | |
| hamdown | # Main Title | |
| Mscgen | # MSC for some fictional process | |
| spry | # Let's add a method to:do: that works as in Smalltalk. | |
| Reia | # Hello, world! | |
| ldpl | # Hello There Example | |
| GraphQL Schema Definition Language | # Enumeration type for a level of priority | |
| E | # E snippet from | |
| Logica | # Define natural numbers from 1 to 29. | |
| starlark | # Define a number | |
| git-config | # Core variables | |
| NestedText | # Contact information for our officers | |
| Mech | # Breakout | |
| Expect | # Assume $remote_server, $my_user_id, $my_password, and $my_command were read in earlier | |
| GDScript | # A file is a class! | |
| RELAX NG | # A RELAX NG compact syntax pattern | |
| Large-scale Atomic/Molecular Massively Parallel Simulator Format | # 2d LJ crack simulation | |
| SubX | # 0x20-0x7e: basic latin | |
| YASnippet | # -*- mode: snippet -*- | |
| Zimpl | # $Id: queens3.zpl,v 1.3 2009/09/13 16:15:53 bzfkocht Exp $ | |
| Filebench WML | # | |
| chevrotain | "use strict" | |
| ARM Templates | "properties": { | |
| Textile | """ | |
| Module Management System | ! | |
| v8torque | macro LoadDataViewUint32(buffer: JSArrayBuffer, offset: intptr, | |
| Makefile | edit : main.o kbd.o command.o display.o \ | |
| OpenSCAD | cube(5); | |
| Meta Expressions | [1;2;3] | |
| tampio | Pienen luvun kertoma on | |
| mmix | LOC Data_Segment | |
| Gentoo Ebuild | Copyright 1999-2018 Gentoo Foundation | |
| Pep8 | BR main | |
| BibTeX | @inproceedings{Gousi13, | |
| PhyloXML | | |
| Esoteric Reaction | ::= |
|
| Guix Workflow Language | ;; https://www.guixwl.org/extended-start | |
| z80 | ; memcpy -- | |
| DOT | // The graph name and the semicolons are optional | |
| StruQL | // Link root page to page of all accounts | |
| Phel | (ns hello-world\boot) | |
| WebAssembly Text Format | (module | |
| CLIPS | (deftemplate car_problem | |
| Argdown | # Welcome to Argdown! | |
| CodeStudAssembler | test al,0x1 | |
| ASCII Armor | -----BEGIN PGP MESSAGE----- | |
| Rosetta-2 | https://dougallj.files.wordpress.com/2022/11/fupg8ipuuaehi0a-1.jpg | |
| Sugar | @module helloworld | |
| Forml | hello_world = do | |
| ca65 Assembly | Label: ; A label and a comment |